Products 2044927-18-4
CAS 2044927-18-4 appears in our catalog under these names: 1-(4-Bromo-2,5-difluorophenyl)ethan-1-amine hydrochloride, 1-(4-Bromo-2,5-difluorophenyl)ethan-1-amine hydrochloride, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 100mg, 1g, 250mg.
1-(4-bromo-2,5-difluorophenyl)ethanamine;hydrochloride (CAS 2044927-18-4) is a chemical compound with the molecular formula C8H9BrClF2N and a molecular weight of 272.52 g/mol. IUPAC name: 1-(4-bromo-2,5-difluorophenyl)ethanamine;hydrochloride. InChIKey: BEMLJGMQSDTWNE-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClF2N |
|---|---|
| Molecular weight | 272.52 g/mol |
| IUPAC name | 1-(4-bromo-2,5-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | BEMLJGMQSDTWNE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1F)Br)F)N.Cl |
Computed by PubChem (NCBI)