CAS 2460740-58-1 appears in our catalog under these names: (R)–1–(4–Bromo–2,6–difluorophenyl)ethan–1–amine hydrochloride, (R)-1-(4-Bromo-2,6-difluorophenyl)ethan-1-amine hydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 0,5g, 50mg.
(1R)-1-(4-bromo-2,6-difluorophenyl)ethanamine;hydrochloride (CAS 2460740-58-1) is a chemical compound with the molecular formula C8H9BrClF2N and a molecular weight of 272.52 g/mol. IUPAC name: (1R)-1-(4-bromo-2,6-difluorophenyl)ethanamine;hydrochloride. InChIKey: RBLSJFGZNFOVSG-PGMHMLKASA-N.
| Molecular formula | C8H9BrClF2N |
|---|---|
| Molecular weight | 272.52 g/mol |
| IUPAC name | (1R)-1-(4-bromo-2,6-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | RBLSJFGZNFOVSG-PGMHMLKASA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1F)Br)F)N.Cl |
Computed by PubChem (NCBI)