CAS 2089648-75-7 is the registry number for 1-(3-BROMOPHENYL)-2,2-DIFLUOROETHAN-1-AMINE HCL, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(3-bromophenyl)-2,2-difluoroethanamine;hydrochloride (CAS 2089648-75-7) is a chemical compound with the molecular formula C8H9BrClF2N and a molecular weight of 272.52 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2-difluoroethanamine;hydrochloride. InChIKey: TVJPBJOILFHRFA-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClF2N |
|---|---|
| Molecular weight | 272.52 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,2-difluoroethanamine;hydrochloride |
| InChIKey | TVJPBJOILFHRFA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(F)F)N.Cl |
Computed by PubChem (NCBI)