CAS 2225127-09-1 is the registry number for (1R)-1-(4-bromophenyl)-2,2-difluoroethan-1-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg.
(1R)-1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride (CAS 2225127-09-1) is a chemical compound with the molecular formula C8H9BrClF2N and a molecular weight of 272.52 g/mol. IUPAC name: (1R)-1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride. InChIKey: ACHCXLPCNPXNTF-OGFXRTJISA-N.
| Molecular formula | C8H9BrClF2N |
|---|---|
| Molecular weight | 272.52 g/mol |
| IUPAC name | (1R)-1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride |
| InChIKey | ACHCXLPCNPXNTF-OGFXRTJISA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(F)F)N)Br.Cl |
Computed by PubChem (NCBI)