CAS 204977-17-3 appears in our catalog under these names: 10-Ethyl-10H-phenothiazine-3,7-dicarbaldehyde, 98%, 98%, 10-Ethyl-10H-phenothiazine-3,7-dicarbaldehyde, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
10-ethylphenothiazine-3,7-dicarbaldehyde (CAS 204977-17-3) is a chemical compound with the molecular formula C16H13NO2S and a molecular weight of 283.3 g/mol. IUPAC name: 10-ethylphenothiazine-3,7-dicarbaldehyde. InChIKey: BDHOBCLIUCKJBN-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2S |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 10-ethylphenothiazine-3,7-dicarbaldehyde |
| InChIKey | BDHOBCLIUCKJBN-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C=O)SC3=C1C=CC(=C3)C=O |
Computed by PubChem (NCBI)