CAS 2050015-91-1 is the registry number for Topiroxostat Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
6-cyanopyridine-2-carbohydrazide (CAS 2050015-91-1) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: 6-cyanopyridine-2-carbohydrazide. InChIKey: VKKDYEXCHBPGHB-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 6-cyanopyridine-2-carbohydrazide |
| InChIKey | VKKDYEXCHBPGHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)NN)C#N |
Computed by PubChem (NCBI)