Products 2052297-74-0
CAS 2052297-74-0 is the registry number for Brivaracetam Impurity 30. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(3R)-N-[(2S)-1-amino-1-oxobutan-2-yl]-3-(chloromethyl)hexanamide (CAS 2052297-74-0) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: (3R)-N-[(2S)-1-amino-1-oxobutan-2-yl]-3-(chloromethyl)hexanamide. InChIKey: GSKKODFCGSQPLP-BDAKNGLRSA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | (3R)-N-[(2S)-1-amino-1-oxobutan-2-yl]-3-(chloromethyl)hexanamide |
| InChIKey | GSKKODFCGSQPLP-BDAKNGLRSA-N |
| SMILES | CCC[C@H](CC(=O)N[C@@H](CC)C(=O)N)CCl |
Computed by PubChem (NCBI)