Products 205252-59-1
CAS 205252-59-1 is the registry number for (all-E)-UAB30. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E,4E,6E,8E)-8-(3,4-dihydro-2H-naphthalen-1-ylidene)-3,7-dimethylocta-2,4,6-trienoic acid (CAS 205252-59-1) is a chemical compound with the molecular formula C20H22O2 and a molecular weight of 294.4 g/mol. IUPAC name: (2E,4E,6E,8E)-8-(3,4-dihydro-2H-naphthalen-1-ylidene)-3,7-dimethylocta-2,4,6-trienoic acid. InChIKey: PPGNMFUMZSAZCW-FRCHHHHOSA-N.
| Molecular formula | C20H22O2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | (2E,4E,6E,8E)-8-(3,4-dihydro-2H-naphthalen-1-ylidene)-3,7-dimethylocta-2,4,6-trienoic acid |
| InChIKey | PPGNMFUMZSAZCW-FRCHHHHOSA-N |
| SMILES | C/C(=C\C(=O)O)/C=C/C=C(\C)/C=C/1\CCCC2=CC=CC=C21 |
Computed by PubChem (NCBI)