Products 205437-62-3
CAS 205437-62-3 appears in our catalog under these names: Dexamfetamine-D6 Hydrochloride (~94 : 6 e.r.), (S)–Amphetamine–D6 Hydrochloride. Offered by: TRC, GLPBio. Available pack sizes: 1mg, 10mg.
(2S)-1,1,1,2,3,3-hexadeuterio-3-phenylpropan-2-amine;hydrochloride (CAS 205437-62-3) is a chemical compound with the molecular formula C9H14ClN and a molecular weight of 177.70 g/mol. IUPAC name: (2S)-1,1,1,2,3,3-hexadeuterio-3-phenylpropan-2-amine;hydrochloride. InChIKey: SEVKYLYIYIKRSW-VMEYXNQBSA-N.
| Molecular formula | C9H14ClN |
|---|---|
| Molecular weight | 177.70 g/mol |
| IUPAC name | (2S)-1,1,1,2,3,3-hexadeuterio-3-phenylpropan-2-amine;hydrochloride |
| InChIKey | SEVKYLYIYIKRSW-VMEYXNQBSA-N |
| SMILES | [2H][C@](C([2H])([2H])[2H])(C([2H])([2H])C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)