Products 2687960-27-4
CAS 2687960-27-4 is the registry number for DL-Amphetamine- 13C6 Hydrochloride. Offered by: TRC. Available pack sizes: 10mg.
1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)propan-2-amine;hydrochloride (CAS 2687960-27-4) is a chemical compound with the molecular formula C9H14ClN and a molecular weight of 177.62 g/mol. IUPAC name: 1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)propan-2-amine;hydrochloride. InChIKey: SEVKYLYIYIKRSW-RDIRWOPYSA-N.
| Molecular formula | C9H14ClN |
|---|---|
| Molecular weight | 177.62 g/mol |
| IUPAC name | 1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)propan-2-amine;hydrochloride |
| InChIKey | SEVKYLYIYIKRSW-RDIRWOPYSA-N |
| SMILES | CC(C[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
DL-Amphetamine- 13C6 Hydrochloride