CAS 2055119-29-2 is the registry number for Methyl 4-bromo-2-(pyrrolidin-1-yl)benzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 4-bromo-2-pyrrolidin-1-ylbenzoate (CAS 2055119-29-2) is a chemical compound with the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. IUPAC name: methyl 4-bromo-2-pyrrolidin-1-ylbenzoate. InChIKey: RLKOAZINJASHOA-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | methyl 4-bromo-2-pyrrolidin-1-ylbenzoate |
| InChIKey | RLKOAZINJASHOA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)N2CCCC2 |
Computed by PubChem (NCBI)