CAS 2055172-15-9 appears in our catalog under these names: (R)-2-Benzylpiperidine hydrochloride, (R)-2-Benzylpiperidine hydrochloride, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 1000mg, 5000mg, 50mg, 100mg, 250mg, 500mg.
(2R)-2-benzylpiperidine;hydrochloride (CAS 2055172-15-9) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: (2R)-2-benzylpiperidine;hydrochloride. InChIKey: QJPBYKFOQQDQSA-UTONKHPSSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | (2R)-2-benzylpiperidine;hydrochloride |
| InChIKey | QJPBYKFOQQDQSA-UTONKHPSSA-N |
| SMILES | C1CCN[C@H](C1)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)