CAS 2055840-36-1 appears in our catalog under these names: (4-Bromophenyl)(cyclopropyl)methanamine hydrochloride, 95%, (4-Bromophenyl)(cyclopropyl)methanamine hydrochloride, 98%, (4-Bromophenyl)(cyclopropyl)methanamine hydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
(4-bromophenyl)-cyclopropylmethanamine;hydrochloride (CAS 2055840-36-1) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: (4-bromophenyl)-cyclopropylmethanamine;hydrochloride. InChIKey: KWXPCXLHNDMVAP-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | (4-bromophenyl)-cyclopropylmethanamine;hydrochloride |
| InChIKey | KWXPCXLHNDMVAP-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)