Products 205808-10-2

CAS 205808-10-2 is the registry number for Elagolix Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidin-2-one (CAS 205808-10-2) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 1-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidin-2-one. InChIKey: BXYMIOKDTRBTMK-NSHDSACASA-N.

Identity
Molecular formulaC12H15NO2
Molecular weight205.25 g/mol
IUPAC name1-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidin-2-one
InChIKeyBXYMIOKDTRBTMK-NSHDSACASA-N
SMILESC1CC(=O)N(C1)[C@@H](CO)C2=CC=CC=C2

Computed by PubChem (NCBI)