CAS 205808-10-2 is the registry number for Elagolix Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidin-2-one (CAS 205808-10-2) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 1-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidin-2-one. InChIKey: BXYMIOKDTRBTMK-NSHDSACASA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 1-[(1R)-2-hydroxy-1-phenylethyl]pyrrolidin-2-one |
| InChIKey | BXYMIOKDTRBTMK-NSHDSACASA-N |
| SMILES | C1CC(=O)N(C1)[C@@H](CO)C2=CC=CC=C2 |
Computed by PubChem (NCBI)