CAS 205873-56-9 appears in our catalog under these names: 3,4-Diacetamidobenzoic acid, 95%, 3,4-Diacetamidobenzoic acid, 95+%, 3,4-Diacetamidobenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 25g, 50g, 100g.
3,4-diacetamidobenzoic acid (CAS 205873-56-9) is a chemical compound with the molecular formula C11H12N2O4 and a molecular weight of 236.22 g/mol. IUPAC name: 3,4-diacetamidobenzoic acid. InChIKey: GHTLCMPYQOFKCS-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 3,4-diacetamidobenzoic acid |
| InChIKey | GHTLCMPYQOFKCS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)