Products 205873-58-1
CAS 205873-58-1 appears in our catalog under these names: Indole-7-carboxylic acid ethyl ester, 95%, Ethyl indole-7-carboxylate, Ethyl 1H-indole-7-carboxylate 95%, Indole-7-carboxylic acid ethyl ester, 98%, 98%, Ethyl 1H-indole-7-carboxylate, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 1000mg, 500mg, 2000mg.
Ethyl 1H-indole-7-carboxylate (CAS 205873-58-1) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: ethyl 1H-indole-7-carboxylate. InChIKey: WZXGOHXFXHUJLR-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | ethyl 1H-indole-7-carboxylate |
| InChIKey | WZXGOHXFXHUJLR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC2=C1NC=C2 |
Computed by PubChem (NCBI)