Products 2059908-56-2
CAS 2059908-56-2 is the registry number for rac-(1R,3R)-2,2-Dimethyl-3-(4-nitrophenyl)cyclobutan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Trans-(1S,3S)-2,2-dimethyl-3-(4-nitrophenyl)cyclobutan-1-ol (CAS 2059908-56-2) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: trans-(1S,3S)-2,2-dimethyl-3-(4-nitrophenyl)cyclobutan-1-ol. InChIKey: ODRIPCLHMNNNND-QWRGUYRKSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | trans-(1S,3S)-2,2-dimethyl-3-(4-nitrophenyl)cyclobutan-1-ol |
| InChIKey | ODRIPCLHMNNNND-QWRGUYRKSA-N |
| SMILES | CC1([C@@H](C[C@@H]1O)C2=CC=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)