Products 2059949-75-4
CAS 2059949-75-4 is the registry number for 3-{(4-(Aminomethyl)phenyl)methyl}imidazolidine-2,4-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[[4-(aminomethyl)phenyl]methyl]imidazolidine-2,4-dione;hydrochloride (CAS 2059949-75-4) is a chemical compound with the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. IUPAC name: 3-[[4-(aminomethyl)phenyl]methyl]imidazolidine-2,4-dione;hydrochloride. InChIKey: QDKLFUDSNZFNSZ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O2 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 3-[[4-(aminomethyl)phenyl]methyl]imidazolidine-2,4-dione;hydrochloride |
| InChIKey | QDKLFUDSNZFNSZ-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)N1)CC2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)