Products 2059971-41-2
CAS 2059971-41-2 is the registry number for (5-Amino-2-fluorophenyl)methanesulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5-amino-2-fluorophenyl)methanesulfonyl fluoride (CAS 2059971-41-2) is a chemical compound with the molecular formula C7H7F2NO2S and a molecular weight of 207.20 g/mol. IUPAC name: (5-amino-2-fluorophenyl)methanesulfonyl fluoride. InChIKey: QAMNLARHIBLWMU-UHFFFAOYSA-N.
| Molecular formula | C7H7F2NO2S |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | (5-amino-2-fluorophenyl)methanesulfonyl fluoride |
| InChIKey | QAMNLARHIBLWMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)CS(=O)(=O)F)F |
Computed by PubChem (NCBI)