Products 2059993-02-9

CAS 2059993-02-9 is the registry number for 2-Methyl-2-(piperazin-1-yl)propanoic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-methyl-2-piperazin-1-ylpropanoic acid;dihydrochloride (CAS 2059993-02-9) is a chemical compound with the molecular formula C8H18Cl2N2O2 and a molecular weight of 245.14 g/mol. IUPAC name: 2-methyl-2-piperazin-1-ylpropanoic acid;dihydrochloride. InChIKey: HGAMLXYUWSGYQG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18Cl2N2O2
Molecular weight245.14 g/mol
IUPAC name2-methyl-2-piperazin-1-ylpropanoic acid;dihydrochloride
InChIKeyHGAMLXYUWSGYQG-UHFFFAOYSA-N
SMILESCC(C)(C(=O)O)N1CCNCC1.Cl.Cl

Computed by PubChem (NCBI)