CAS 2060000-69-1 is the registry number for (2,2-Dimethyl-1-phenylcyclopropyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
(2,2-dimethyl-1-phenylcyclopropyl)methanamine;hydrochloride (CAS 2060000-69-1) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: (2,2-dimethyl-1-phenylcyclopropyl)methanamine;hydrochloride. InChIKey: ADIOXIBZWVSWIJ-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | (2,2-dimethyl-1-phenylcyclopropyl)methanamine;hydrochloride |
| InChIKey | ADIOXIBZWVSWIJ-UHFFFAOYSA-N |
| SMILES | CC1(CC1(CN)C2=CC=CC=C2)C.Cl |
Computed by PubChem (NCBI)