CAS 2060021-52-3 appears in our catalog under these names: Methyl 2-amino-3-(4-chlorophenyl)-2-methylpropanoate hydrochloride, 95%, Methyl 2-amino-3-(4-chlorophenyl)-2-methylpropanoate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-amino-3-(4-chlorophenyl)-2-methylpropanoate;hydrochloride (CAS 2060021-52-3) is a chemical compound with the molecular formula C11H15Cl2NO2 and a molecular weight of 264.14 g/mol. IUPAC name: methyl 2-amino-3-(4-chlorophenyl)-2-methylpropanoate;hydrochloride. InChIKey: LULOIOMCCWQZPZ-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO2 |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | methyl 2-amino-3-(4-chlorophenyl)-2-methylpropanoate;hydrochloride |
| InChIKey | LULOIOMCCWQZPZ-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)Cl)(C(=O)OC)N.Cl |
Computed by PubChem (NCBI)