CAS 2060053-50-9 is the registry number for tert-Butyl 7-fluoro-2,3,4,5-tetrahydro-1,4-benzoxazepine-4-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 7-fluoro-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate (CAS 2060053-50-9) is a chemical compound with the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. IUPAC name: tert-butyl 7-fluoro-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate. InChIKey: ZQOOAKFEPKRDBE-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO3 |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | tert-butyl 7-fluoro-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
| InChIKey | ZQOOAKFEPKRDBE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C(C1)C=C(C=C2)F |
Computed by PubChem (NCBI)