CAS 20608-87-1 is the registry number for 2-(Thiophen-3-yl)benzoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-thiophen-3-ylbenzoic acid (CAS 20608-87-1) is a chemical compound with the molecular formula C11H8O2S and a molecular weight of 204.25 g/mol. IUPAC name: 2-thiophen-3-ylbenzoic acid. InChIKey: FRQNAMNFPWSQAW-UHFFFAOYSA-N.
| Molecular formula | C11H8O2S |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 2-thiophen-3-ylbenzoic acid |
| InChIKey | FRQNAMNFPWSQAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC=C2)C(=O)O |
Computed by PubChem (NCBI)