CAS 2061979-68-6 is the registry number for 2-(5-(3-Chlorophenyl)-1H-1,2,3-triazol-1-yl)cyclopentanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg.
2-[5-(3-chlorophenyl)triazol-1-yl]cyclopentan-1-ol (CAS 2061979-68-6) is a chemical compound with the molecular formula C13H14ClN3O and a molecular weight of 263.72 g/mol. IUPAC name: 2-[5-(3-chlorophenyl)triazol-1-yl]cyclopentan-1-ol. InChIKey: SBNRHBIPMQIJRX-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 2-[5-(3-chlorophenyl)triazol-1-yl]cyclopentan-1-ol |
| InChIKey | SBNRHBIPMQIJRX-UHFFFAOYSA-N |
| SMILES | C1CC(C(C1)O)N2C(=CN=N2)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)