CAS 2061996-49-2 appears in our catalog under these names: (S)-1-(4-Chlorophenyl)-n-methylethanamine hydrochloride, 95%, (S)–1–(4–Chlorophenyl)–N–methylethanamine hydrochloride, (S)-1-(4-chlorophenyl)-N-methylethanamine hydrochloride, (S)-1-(4-Chlorophenyl)-N-methylethanamine hydrochloride 97%, (S)-1-(4-Chlorophenyl)-N-methylethanamine hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g, 10g.
(1S)-1-(4-chlorophenyl)-N-methylethanamine;hydrochloride (CAS 2061996-49-2) is a chemical compound with the molecular formula C9H13Cl2N and a molecular weight of 206.11 g/mol. IUPAC name: (1S)-1-(4-chlorophenyl)-N-methylethanamine;hydrochloride. InChIKey: FNFAFYJSZXBEBR-FJXQXJEOSA-N.
| Molecular formula | C9H13Cl2N |
|---|---|
| Molecular weight | 206.11 g/mol |
| IUPAC name | (1S)-1-(4-chlorophenyl)-N-methylethanamine;hydrochloride |
| InChIKey | FNFAFYJSZXBEBR-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)Cl)NC.Cl |
Computed by PubChem (NCBI)