CAS 29850-85-9 appears in our catalog under these names: (R)-1-(4-Chlorophenyl)-n-methylethanamine hydrochloride, 95%, (R)–1–(4–Chlorophenyl)–N–methylethanamine hydrochloride, (R)-1-(4-Chlorophenyl)-N-methylethanamine hydrochloride, (R)-1-(4-Chlorophenyl)-N-methylethanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(1R)-1-(4-chlorophenyl)-N-methylethanamine;hydrochloride (CAS 29850-85-9) is a chemical compound with the molecular formula C9H13Cl2N and a molecular weight of 206.11 g/mol. IUPAC name: (1R)-1-(4-chlorophenyl)-N-methylethanamine;hydrochloride. InChIKey: FNFAFYJSZXBEBR-OGFXRTJISA-N.
| Molecular formula | C9H13Cl2N |
|---|---|
| Molecular weight | 206.11 g/mol |
| IUPAC name | (1R)-1-(4-chlorophenyl)-N-methylethanamine;hydrochloride |
| InChIKey | FNFAFYJSZXBEBR-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)Cl)NC.Cl |
Computed by PubChem (NCBI)