CAS 2061996-86-7 appears in our catalog under these names: (S)-1-(3-(1-Aminoethyl)phenyl)ethanone hydrochloride, 95%, (S)–1–(3–(1–aminoethyl)phenyl)ethanone hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
1-[3-[(1S)-1-aminoethyl]phenyl]ethanone;hydrochloride (CAS 2061996-86-7) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 1-[3-[(1S)-1-aminoethyl]phenyl]ethanone;hydrochloride. InChIKey: ZLIOXJUIOKKTOZ-FJXQXJEOSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 1-[3-[(1S)-1-aminoethyl]phenyl]ethanone;hydrochloride |
| InChIKey | ZLIOXJUIOKKTOZ-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)C(=O)C)N.Cl |
Computed by PubChem (NCBI)