CAS 20629-91-8 is the registry number for 2-(3-Chlorophenyl)-5-methyl-2,3-dihydro-1h-pyrazol-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-(3-chlorophenyl)-5-methyl-1H-pyrazol-3-one (CAS 20629-91-8) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 208.64 g/mol. IUPAC name: 2-(3-chlorophenyl)-5-methyl-1H-pyrazol-3-one. InChIKey: HRBCDVLFVGOSIC-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-5-methyl-1H-pyrazol-3-one |
| InChIKey | HRBCDVLFVGOSIC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(N1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)