Products 2064217-73-6
CAS 2064217-73-6 appears in our catalog under these names: 5-Chloro-7-(trifluoromethyl)imidazo(1,5-a)pyridine, 98%, 5-Chloro-7-(trifluoromethyl)imidazo[1,5-a]pyridine, 98%, 98%, 5-Chloro-7-(trifluoromethyl)imidazo[1,5-a]pyridine, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
5-chloro-7-(trifluoromethyl)imidazo[1,5-a]pyridine (CAS 2064217-73-6) is a chemical compound with the molecular formula C8H4ClF3N2 and a molecular weight of 220.58 g/mol. IUPAC name: 5-chloro-7-(trifluoromethyl)imidazo[1,5-a]pyridine. InChIKey: LCOMMPANBJEMLN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2 |
|---|---|
| Molecular weight | 220.58 g/mol |
| IUPAC name | 5-chloro-7-(trifluoromethyl)imidazo[1,5-a]pyridine |
| InChIKey | LCOMMPANBJEMLN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N2C1=CN=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)