CAS 20651-75-6 appears in our catalog under these names: 1-Butyl-4-nitrobenzene, 95%, 1-Butyl-4-nitrobenzene, 96%, 1–Butyl–4–nitrobenzene, 1-Butyl-4-nitrobenzene, >96.0%(GC), 1-Butyl-4-nitrobenzene. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 10g, 25g.
1-butyl-4-nitrobenzene (CAS 20651-75-6) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 1-butyl-4-nitrobenzene. InChIKey: JZRBCNLSIDKBMG-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 1-butyl-4-nitrobenzene |
| InChIKey | JZRBCNLSIDKBMG-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)