CAS 20669-52-7 is the registry number for 3-Phenyl-1,2-dihydronaphthalene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
3-phenyl-1,2-dihydronaphthalene (CAS 20669-52-7) is a chemical compound with the molecular formula C16H14 and a molecular weight of 206.28 g/mol. IUPAC name: 3-phenyl-1,2-dihydronaphthalene. InChIKey: CGCRJJZWGYGLHB-UHFFFAOYSA-N.
| Molecular formula | C16H14 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 3-phenyl-1,2-dihydronaphthalene |
| InChIKey | CGCRJJZWGYGLHB-UHFFFAOYSA-N |
| SMILES | C1CC(=CC2=CC=CC=C21)C3=CC=CC=C3 |
Computed by PubChem (NCBI)