Products 20669-52-7

CAS 20669-52-7 is the registry number for 3-Phenyl-1,2-dihydronaphthalene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

3-phenyl-1,2-dihydronaphthalene (CAS 20669-52-7) is a chemical compound with the molecular formula C16H14 and a molecular weight of 206.28 g/mol. IUPAC name: 3-phenyl-1,2-dihydronaphthalene. InChIKey: CGCRJJZWGYGLHB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14
Molecular weight206.28 g/mol
IUPAC name3-phenyl-1,2-dihydronaphthalene
InChIKeyCGCRJJZWGYGLHB-UHFFFAOYSA-N
SMILESC1CC(=CC2=CC=CC=C21)C3=CC=CC=C3

Computed by PubChem (NCBI)