CAS 2069-48-9 appears in our catalog under these names: (4-Chlorophenyl)(4-fluorophenyl)methanone, 98%, (4-Chlorophenyl)(4-fluorophenyl)methanone 98%, 4-Chloro-4'-fluorobenzophenone, 95%, 95%, 4-Chloro-4'-fluorobenzophenone, 92%+. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg.
(4-chlorophenyl)-(4-fluorophenyl)methanone (CAS 2069-48-9) is a chemical compound with the molecular formula C13H8ClFO and a molecular weight of 234.65 g/mol. IUPAC name: (4-chlorophenyl)-(4-fluorophenyl)methanone. InChIKey: YGROSAOZMCLHSW-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFO |
|---|---|
| Molecular weight | 234.65 g/mol |
| IUPAC name | (4-chlorophenyl)-(4-fluorophenyl)methanone |
| InChIKey | YGROSAOZMCLHSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)Cl)F |
Computed by PubChem (NCBI)