Products 842140-45-8
CAS 842140-45-8 appears in our catalog under these names: 4'-Chloro-3'-fluoro[1,1'-biphenyl]-4-carbaldehyde, 95%, 4'-Chloro-3'-fluoro[1,1'-biphenyl]-4-carbaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g.
4-(4-chloro-3-fluorophenyl)benzaldehyde (CAS 842140-45-8) is a chemical compound with the molecular formula C13H8ClFO and a molecular weight of 234.65 g/mol. IUPAC name: 4-(4-chloro-3-fluorophenyl)benzaldehyde. InChIKey: UDKIDYYYCVXONJ-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFO |
|---|---|
| Molecular weight | 234.65 g/mol |
| IUPAC name | 4-(4-chloro-3-fluorophenyl)benzaldehyde |
| InChIKey | UDKIDYYYCVXONJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC(=C(C=C2)Cl)F |
Computed by PubChem (NCBI)