Products 46698-36-6
CAS 46698-36-6 is the registry number for (4-Chlorophenyl)(3-fluorophenyl)methanone, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
(4-chlorophenyl)-(3-fluorophenyl)methanone (CAS 46698-36-6) is a chemical compound with the molecular formula C13H8ClFO and a molecular weight of 234.65 g/mol. IUPAC name: (4-chlorophenyl)-(3-fluorophenyl)methanone. InChIKey: FIFXBQVRZOTUNN-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFO |
|---|---|
| Molecular weight | 234.65 g/mol |
| IUPAC name | (4-chlorophenyl)-(3-fluorophenyl)methanone |
| InChIKey | FIFXBQVRZOTUNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)