Products 59396-44-0
CAS 59396-44-0 is the registry number for (4-Chlorophenyl)(2-fluorophenyl)methanone. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(4-chlorophenyl)-(2-fluorophenyl)methanone (CAS 59396-44-0) is a chemical compound with the molecular formula C13H8ClFO and a molecular weight of 234.65 g/mol. IUPAC name: (4-chlorophenyl)-(2-fluorophenyl)methanone. InChIKey: QSWKFJLPMWWZJE-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFO |
|---|---|
| Molecular weight | 234.65 g/mol |
| IUPAC name | (4-chlorophenyl)-(2-fluorophenyl)methanone |
| InChIKey | QSWKFJLPMWWZJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)F |
Computed by PubChem (NCBI)