Products 206990-64-9

CAS 206990-64-9 is the registry number for Esomeprazole Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3,5-dimethyl-2-pyridinyl)methyl acetate (CAS 206990-64-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (3,5-dimethyl-2-pyridinyl)methyl acetate. InChIKey: WREAEHBWBSOXJC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO2
Molecular weight179.22 g/mol
IUPAC name(3,5-dimethyl-2-pyridinyl)methyl acetate
InChIKeyWREAEHBWBSOXJC-UHFFFAOYSA-N
SMILESCC1=CC(=C(N=C1)COC(=O)C)C

Computed by PubChem (NCBI)