CAS 206990-64-9 is the registry number for Esomeprazole Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
(3,5-dimethyl-2-pyridinyl)methyl acetate (CAS 206990-64-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (3,5-dimethyl-2-pyridinyl)methyl acetate. InChIKey: WREAEHBWBSOXJC-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (3,5-dimethyl-2-pyridinyl)methyl acetate |
| InChIKey | WREAEHBWBSOXJC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)COC(=O)C)C |
Computed by PubChem (NCBI)