Products 2070015-30-2
CAS 2070015-30-2 is the registry number for Mebeverine Acid-d5. Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg.
4-[1-(4-methoxyphenyl)propan-2-yl-(1,1,2,2,2-pentadeuterioethyl)amino]butanoic acid (CAS 2070015-30-2) is a chemical compound with the molecular formula C16H25NO3 and a molecular weight of 284.40 g/mol. IUPAC name: 4-[1-(4-methoxyphenyl)propan-2-yl-(1,1,2,2,2-pentadeuterioethyl)amino]butanoic acid. InChIKey: UZUWRVLVHOYTNN-SGEUAGPISA-N.
| Molecular formula | C16H25NO3 |
|---|---|
| Molecular weight | 284.40 g/mol |
| IUPAC name | 4-[1-(4-methoxyphenyl)propan-2-yl-(1,1,2,2,2-pentadeuterioethyl)amino]butanoic acid |
| InChIKey | UZUWRVLVHOYTNN-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(CCCC(=O)O)C(C)CC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)