CAS 207405-71-8 appears in our catalog under these names: Rel-(2R,3R)-1-(tert-butoxycarbonyl)-3-phenylazetidine-2-carboxylic acid, 98%, rac-(2R,3R)-1-((tert-Butoxy)carbonyl)-3-phenylazetidine-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
(2R,3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-phenylazetidine-2-carboxylic acid (CAS 207405-71-8) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: (2R,3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-phenylazetidine-2-carboxylic acid. InChIKey: HXVYFISMZPHYRM-NWDGAFQWSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (2R,3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-phenylazetidine-2-carboxylic acid |
| InChIKey | HXVYFISMZPHYRM-NWDGAFQWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H]1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)