Products 207856-85-7
CAS 207856-85-7 appears in our catalog under these names: Glycopyrronium Bromide Impurity 8, Glycopyrrolate Impurity 10, Glycopyrrolate Impurity 23. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(3S)-1-methylpyrrolidin-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate (CAS 207856-85-7) is a chemical compound with the molecular formula C18H25NO3 and a molecular weight of 303.4 g/mol. IUPAC name: [(3S)-1-methylpyrrolidin-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate. InChIKey: OVGMKPGXRHJNKJ-WMZOPIPTSA-N.
| Molecular formula | C18H25NO3 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | [(3S)-1-methylpyrrolidin-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| InChIKey | OVGMKPGXRHJNKJ-WMZOPIPTSA-N |
| SMILES | CN1CC[C@@H](C1)OC(=O)[C@@](C2CCCC2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)