Products 937179-78-7
CAS 937179-78-7 appears in our catalog under these names: Glycopyrronium Bromide Impurity 7, Glycopyrrolate Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R)-1-methylpyrrolidin-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetate (CAS 937179-78-7) is a chemical compound with the molecular formula C18H25NO3 and a molecular weight of 303.4 g/mol. IUPAC name: [(3R)-1-methylpyrrolidin-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetate. InChIKey: OVGMKPGXRHJNKJ-SJLPKXTDSA-N.
| Molecular formula | C18H25NO3 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | [(3R)-1-methylpyrrolidin-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| InChIKey | OVGMKPGXRHJNKJ-SJLPKXTDSA-N |
| SMILES | CN1CC[C@H](C1)OC(=O)[C@](C2CCCC2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)