CAS 207974-09-2 appears in our catalog under these names: (2–Fluoro–5–(trifluoromethyl)phenyl)methanol, 2-Fluoro-5-(trifluoromethyl)benzyl alcohol, 80%, (2-Fluoro-5-(trifluoromethyl)phenyl)methanol 80%, 2-Fluoro-5-(trifluoromethyl)benzyl alcohol, 97%, 2-Fluoro-5-(trifluoromethyl)benzyl alcohol, 97%, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 10g, 500g.
[2-fluoro-5-(trifluoromethyl)phenyl]methanol (CAS 207974-09-2) is a chemical compound with the molecular formula C8H6F4O and a molecular weight of 194.13 g/mol. IUPAC name: [2-fluoro-5-(trifluoromethyl)phenyl]methanol. InChIKey: LFWIVOZRZSAKAL-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O |
|---|---|
| Molecular weight | 194.13 g/mol |
| IUPAC name | [2-fluoro-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | LFWIVOZRZSAKAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CO)F |
Computed by PubChem (NCBI)