CAS 81577-10-8 appears in our catalog under these names: 1-(3-Fluorophenyl)-2,2,2-trifluoroethanol, 95%, 2,2,2–Trifluoro–1–(3–fluorophenyl)ethanol, 1-(3-Fluorophenyl)-2,2,2-trifluoroethanol, 97%, 97%, 2,2,2-TRIFLUORO-1-(3-FLUOROPHENYL)ETHANOL, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 50mg, 100mg, 10g.
2,2,2-trifluoro-1-(3-fluorophenyl)ethanol (CAS 81577-10-8) is a chemical compound with the molecular formula C8H6F4O and a molecular weight of 194.13 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-fluorophenyl)ethanol. InChIKey: VFXAHGNGZGBILK-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O |
|---|---|
| Molecular weight | 194.13 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-fluorophenyl)ethanol |
| InChIKey | VFXAHGNGZGBILK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C(F)(F)F)O |
Computed by PubChem (NCBI)