CAS 238742-82-0 appears in our catalog under these names: 5-Fluoro-2-(trifluoromethyl)benzyl alcohol, 95%, (5-Fluoro-2-(trifluoromethyl)phenyl)methanol, 98%, 5-Fluoro-2-(trifluoromethyl)benzyl alcohol, 97%+,RG, 97%+,RG, 5-Fluoro-2-(trifluoromethyl)benzyl alcohol. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 250mg.
[5-fluoro-2-(trifluoromethyl)phenyl]methanol (CAS 238742-82-0) is a chemical compound with the molecular formula C8H6F4O and a molecular weight of 194.13 g/mol. IUPAC name: [5-fluoro-2-(trifluoromethyl)phenyl]methanol. InChIKey: AGVUJWYLCSOJDS-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O |
|---|---|
| Molecular weight | 194.13 g/mol |
| IUPAC name | [5-fluoro-2-(trifluoromethyl)phenyl]methanol |
| InChIKey | AGVUJWYLCSOJDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CO)C(F)(F)F |
Computed by PubChem (NCBI)