Products 261951-83-1
CAS 261951-83-1 appears in our catalog under these names: 3-Fluoro-2-(trifluoromethyl)benzyl alcohol, 95%, (3-Fluoro-2-(trifluoromethyl)phenyl)methanol 95+%, (3-Fluoro-2-(trifluoromethyl)phenyl)methanol, 95+%, 95+%, 3-Fluoro-2-(trifluoromethyl)benzyl alcohol, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 10g, 5g, 25g.
[3-fluoro-2-(trifluoromethyl)phenyl]methanol (CAS 261951-83-1) is a chemical compound with the molecular formula C8H6F4O and a molecular weight of 194.13 g/mol. IUPAC name: [3-fluoro-2-(trifluoromethyl)phenyl]methanol. InChIKey: WDLGIHLFVHJXAK-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O |
|---|---|
| Molecular weight | 194.13 g/mol |
| IUPAC name | [3-fluoro-2-(trifluoromethyl)phenyl]methanol |
| InChIKey | WDLGIHLFVHJXAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(F)(F)F)CO |
Computed by PubChem (NCBI)