CAS 208054-15-3 appears in our catalog under these names: 4,7-Dichloro-2,9-dimethyl-1,10-phenanthroline, 97%, 4,7-Dichloro-2,9-dimethyl-1,10-phenanthroline, 98%, 98%, 4,7-Dichloro-2,9-dimethyl-1,10-phenanthroline, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4,7-dichloro-2,9-dimethyl-1,10-phenanthroline (CAS 208054-15-3) is a chemical compound with the molecular formula C14H10Cl2N2 and a molecular weight of 277.1 g/mol. IUPAC name: 4,7-dichloro-2,9-dimethyl-1,10-phenanthroline. InChIKey: SCEUZNMSPNDKPX-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2N2 |
|---|---|
| Molecular weight | 277.1 g/mol |
| IUPAC name | 4,7-dichloro-2,9-dimethyl-1,10-phenanthroline |
| InChIKey | SCEUZNMSPNDKPX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC3=C(C=C(N=C3C2=N1)C)Cl)Cl |
Computed by PubChem (NCBI)