CAS 208118-13-2 appears in our catalog under these names: 2-Benzyl-1 H -benzoimidazole-5-carboxylic acid, 2-Benzyl-1H-benzo(d)imidazole-5-carboxylic acid, 97%. Offered by: Fluorochem, AmBeed. Available pack sizes: 1g.
2-benzyl-3H-benzimidazole-5-carboxylic acid (CAS 208118-13-2) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 2-benzyl-3H-benzimidazole-5-carboxylic acid. InChIKey: MVYLIYKCQPPISO-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 2-benzyl-3H-benzimidazole-5-carboxylic acid |
| InChIKey | MVYLIYKCQPPISO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC3=C(N2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)