CAS 208176-32-3 appears in our catalog under these names: Ethyl 5-amino-2-bromobenzoate, 95%, 5-Amino-2-bromobenzoic acid ethyl ester, Ethyl 5-amino-2-bromobenzoate, 97%, 97%, Ethyl 5-amino-2-bromobenzoate, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg, 1000mg, 2000mg, 100mg.
Ethyl 5-amino-2-bromobenzoate (CAS 208176-32-3) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: ethyl 5-amino-2-bromobenzoate. InChIKey: MOZORCINMBZQSL-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | ethyl 5-amino-2-bromobenzoate |
| InChIKey | MOZORCINMBZQSL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)N)Br |
Computed by PubChem (NCBI)