Products 208263-77-8

CAS 208263-77-8 is the registry number for PCB No. 3 13C12 40 µg/mL in Isooctane. Offered by: Dr. Ehrenstorfer. Available pack sizes: 5ml, 1ml.

Structural formula: {0} (CAS {1})

1-chloro-4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 208263-77-8) is a chemical compound with the molecular formula C12H9Cl and a molecular weight of 200.56 g/mol. IUPAC name: 1-chloro-4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: FPWNLURCHDRMHC-WCGVKTIYSA-N.

Identity
Molecular formulaC12H9Cl
Molecular weight200.56 g/mol
IUPAC name1-chloro-4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene
InChIKeyFPWNLURCHDRMHC-WCGVKTIYSA-N
SMILES[13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)Cl

Computed by PubChem (NCBI)