CAS 51624-37-4 is the registry number for 4-Chlorobiphenyl-2',3',4',5',6'-d5, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1-(4-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene (CAS 51624-37-4) is a chemical compound with the molecular formula C12H9Cl and a molecular weight of 193.68 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene. InChIKey: FPWNLURCHDRMHC-RALIUCGRSA-N.
| Molecular formula | C12H9Cl |
|---|---|
| Molecular weight | 193.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene |
| InChIKey | FPWNLURCHDRMHC-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC=C(C=C2)Cl)[2H])[2H] |
Computed by PubChem (NCBI)