Products 51624-37-4

CAS 51624-37-4 is the registry number for 4-Chlorobiphenyl-2',3',4',5',6'-d5, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

1-(4-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene (CAS 51624-37-4) is a chemical compound with the molecular formula C12H9Cl and a molecular weight of 193.68 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene. InChIKey: FPWNLURCHDRMHC-RALIUCGRSA-N.

Identity
Molecular formulaC12H9Cl
Molecular weight193.68 g/mol
IUPAC name1-(4-chlorophenyl)-2,3,4,5,6-pentadeuteriobenzene
InChIKeyFPWNLURCHDRMHC-RALIUCGRSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC=C(C=C2)Cl)[2H])[2H]

Computed by PubChem (NCBI)